C16H26N2O3S — CID 166824772
N-[1-(1-hydroxyethyl)piperidin-3-yl]-3-propan-2-ylbenzenesulfonamide (PubChem CID 166824772) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[1-(1-hydroxyethyl)piperidin-3-yl]-3-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[1-(1-hydroxyethyl)piperidin-3-yl]-3-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 166824772 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[1-(1-hydroxyethyl)piperidin-3-yl]-3-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1cccc(S(=O)(=O)NC2CCCN(C(C)O)C2)c1 |
| InChI | InChI=1S/C16H26N2O3S/c1-12(2)14-6-4-8-16(10-14)22(20,21)17-15-7-5-9-18(11-15)13(3)19/h4,6,8,10,12-13,15,17,19H,5,7,9,11H2,1-3H3 |
| InChIKey | JOPAYDBRLGHHOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |