C23H26F2N2O4S — CID 75935188
N-[[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 75935188) has the molecular formula C23H26F2N2O4S and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 75935188 |
| Molecular Formula | C23H26F2N2O4S |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCCN(C(=O)C=Cc3ccccc3OC(F)F)C2)cc1 |
| InChI | InChI=1S/C23H26F2N2O4S/c1-17-8-11-20(12-9-17)32(29,30)26-15-18-5-4-14-27(16-18)22(28)13-10-19-6-2-3-7-21(19)31-23(24)25/h2-3,6-13,18,23,26H,4-5,14-16H2,1H3 |
| InChIKey | BRBJSIGPIKJNCT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|