C22H24Cl2N2O3S — CID 76879503
N-[[1-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 76879503) has the molecular formula C22H24Cl2N2O3S and a molecular weight of 467.42 g/mol. Its IUPAC name is N-[[1-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 76879503 |
| Molecular Formula | C22H24Cl2N2O3S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[[1-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCCN(C(=O)C=Cc3ccc(Cl)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O3S/c1-16-4-8-19(9-5-16)30(28,29)25-14-18-3-2-12-26(15-18)22(27)11-7-17-6-10-20(23)21(24)13-17/h4-11,13,18,25H,2-3,12,14-15H2,1H3 |
| InChIKey | FQRFIJDRAQQHSV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|