C34H38N4O10S — CID 151891436
ethyl 1-[(E)-3-[4-[4-[(E)-3-(3-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-nitrophenyl]sulfanyl-3-nitrophenyl]prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 151891436) has the molecular formula C34H38N4O10S and a molecular weight of 694.76 g/mol. Its IUPAC name is ethyl 1-[(E)-3-[4-[4-[(E)-3-(3-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-nitrophenyl]sulfanyl-3-nitrophenyl]prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(E)-3-[4-[4-[(E)-3-(3-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-nitrophenyl]sulfanyl-3-nitrophenyl]prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 151891436 |
| Molecular Formula | C34H38N4O10S |
| Molecular Weight | 694.76 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | ethyl 1-[(E)-3-[4-[4-[(E)-3-(3-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-nitrophenyl]sulfanyl-3-nitrophenyl]prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)/C=C/c2ccc(Sc3ccc(/C=C/C(=O)N4CCCC(C(=O)OCC)C4)cc3[N+](=O)[O-])c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C34H38N4O10S/c1-3-47-33(41)25-7-5-17-35(21-25)31(39)15-11-23-9-13-29(27(19-23)37(43)44)49-30-14-10-24(20-28(30)38(45)46)12-16-32(40)36-18-6-8-26(22-36)34(42)48-4-2/h9-16,19-20,25-26H,3-8,17-18,21-22H2,1-2H3/b15-11+,16-12+ |
| InChIKey | SQUWGZSPLNENAK-JOBJLJCHSA-N |
| XLogP | 5.28 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.76 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|