C26H30N2O5S — CID 22498426
ethyl 1-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 22498426) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is ethyl 1-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 22498426 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | ethyl 1-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | C=C(C(=O)N1CCCC(C(=O)OCC)C1)c1ccc(Sc2ccccc2C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-33-26(30)20-9-8-14-27(16-20)25(29)18(4)19-12-13-24(22(15-19)28(31)32)34-23-11-7-6-10-21(23)17(2)3/h6-7,10-13,15,17,20H,4-5,8-9,14,16H2,1-3H3 |
| InChIKey | UFDKTZNPUYDECS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|