C27H32N4O6S — CID 22498211
methyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 22498211) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is methyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | methyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22498211 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | methyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | C=C(C(=O)N1CCN(C(=O)OC)C(C(=O)N(C)C)C1)c1ccc(Sc2ccccc2C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H32N4O6S/c1-17(2)20-9-7-8-10-23(20)38-24-12-11-19(15-21(24)31(35)36)18(3)25(32)29-13-14-30(27(34)37-6)22(16-29)26(33)28(4)5/h7-12,15,17,22H,3,13-14,16H2,1-2,4-6H3 |
| InChIKey | HNYGDQCQZULCLT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|