C23H25N3O4S — CID 22498268
1-(4-acetylpiperazin-1-yl)-2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrophenyl]prop-2-en-1-one (PubChem CID 22498268) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrophenyl]prop-2-en-1-one.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 22498268 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrophenyl]prop-2-en-1-one |
| SMILES | C=C(C(=O)N1CCN(C(C)=O)CC1)c1ccc(Sc2ccc(C)cc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-15-5-7-21(16(2)13-15)31-22-8-6-19(14-20(22)26(29)30)17(3)23(28)25-11-9-24(10-12-25)18(4)27/h5-8,13-14H,3,9-12H2,1-2,4H3 |
| InChIKey | LNTXYRLYWCWBNP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|