C25H19Cl2N3O6S — CID 22023162
1-[4-[2-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)ethane-1,2-dione (PubChem CID 22023162) has the molecular formula C25H19Cl2N3O6S and a molecular weight of 560.42 g/mol. Its IUPAC name is 1-[4-[2-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-[2-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 22023162 |
| Molecular Formula | C25H19Cl2N3O6S |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 1-[4-[2-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]prop-2-enoyl]piperazin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
| SMILES | C=C(C(=O)N1CCN(C(=O)C(=O)c2ccco2)CC1)c1ccc(Sc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19Cl2N3O6S/c1-15(24(32)28-8-10-29(11-9-28)25(33)23(31)20-3-2-12-36-20)16-4-6-22(19(13-16)30(34)35)37-21-7-5-17(26)14-18(21)27/h2-7,12-14H,1,8-11H2 |
| InChIKey | DQJIITVWOGPKGA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|