C20H19Cl2N3O5S2 — CID 10324240
(E)-3-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 10324240) has the molecular formula C20H19Cl2N3O5S2 and a molecular weight of 516.43 g/mol. Its IUPAC name is (E)-3-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10324240 |
| Molecular Formula | C20H19Cl2N3O5S2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | (E)-3-[4-(2,4-dichlorophenyl)sulfanyl-3-nitrophenyl]-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)/C=C/c2ccc(Sc3ccc(Cl)cc3Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H19Cl2N3O5S2/c1-32(29,30)24-10-8-23(9-11-24)20(26)7-3-14-2-5-19(17(12-14)25(27)28)31-18-6-4-15(21)13-16(18)22/h2-7,12-13H,8-11H2,1H3/b7-3+ |
| InChIKey | UZEQDEWUKHWIPV-XVNBXDOJSA-N |
| XLogP | 4.17 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|