C19H21ClN4O6S — CID 55451723
(E)-3-(4-chloro-3-nitrophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 55451723) has the molecular formula C19H21ClN4O6S and a molecular weight of 468.92 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55451723 |
| Molecular Formula | C19H21ClN4O6S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(C(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H21ClN4O6S/c1-13-19(14(2)30-21-13)31(28,29)23-9-3-8-22(10-11-23)18(25)7-5-15-4-6-16(20)17(12-15)24(26)27/h4-7,12H,3,8-11H2,1-2H3/b7-5+ |
| InChIKey | QVAYIKZHLIZOJW-FNORWQNLSA-N |
| XLogP | 2.79 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|