C21H27N5O6S — CID 27364436
[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 27364436) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 27364436 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(C(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H27N5O6S/c1-15-20(16(2)32-22-15)33(30,31)25-12-10-24(11-13-25)21(27)17-6-7-18(19(14-17)26(28)29)23-8-4-3-5-9-23/h6-7,14H,3-5,8-13H2,1-2H3 |
| InChIKey | SYDUKPMHNPRGEU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|