C17H23ClN4O4S — CID 119697352
(4-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methanone;hydrochloride (PubChem CID 119697352) has the molecular formula C17H23ClN4O4S and a molecular weight of 414.92 g/mol. Its IUPAC name is (4-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methanone;hydrochloride.
| Compound Name | (4-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119697352 |
| Molecular Formula | C17H23ClN4O4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (4-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methanone;hydrochloride |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(C(=O)c2ccc(N)cc2)CC1.Cl |
| InChI | InChI=1S/C17H22N4O4S.ClH/c1-12-16(13(2)25-19-12)26(23,24)21-9-3-8-20(10-11-21)17(22)14-4-6-15(18)7-5-14;/h4-7H,3,8-11,18H2,1-2H3;1H |
| InChIKey | BZGXJHZWSGWENW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|