C16H21ClN4O4S — CID 119694725
(3-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methanone;hydrochloride (PubChem CID 119694725) has the molecular formula C16H21ClN4O4S and a molecular weight of 400.89 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (3-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119694725 |
| Molecular Formula | C16H21ClN4O4S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (3-aminophenyl)-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(C(=O)c2cccc(N)c2)CC1.Cl |
| InChI | InChI=1S/C16H20N4O4S.ClH/c1-11-15(12(2)24-18-11)25(22,23)20-8-6-19(7-9-20)16(21)13-4-3-5-14(17)10-13;/h3-5,10H,6-9,17H2,1-2H3;1H |
| InChIKey | XJNCBMUFRHEKPH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|