C18H21N3O4S2 — CID 9151401
(E)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-3-phenylsulfanylprop-2-en-1-one (PubChem CID 9151401) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (E)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-3-phenylsulfanylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-3-phenylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 9151401 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (E)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-3-phenylsulfanylprop-2-en-1-one |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(C(=O)/C=C/Sc2ccccc2)CC1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-14-18(15(2)25-19-14)27(23,24)21-11-9-20(10-12-21)17(22)8-13-26-16-6-4-3-5-7-16/h3-8,13H,9-12H2,1-2H3/b13-8+ |
| InChIKey | YNUBTOONFCILHX-MDWZMJQESA-N |
| XLogP | 2.43 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|