C20H22N4O6S — CID 45354210
2-[1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 45354210) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is 2-[1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45354210 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C20H22N4O6S/c1-12-17(14(3)30-21-12)31(28,29)23-10-8-22(9-11-23)18(25)13(2)24-19(26)15-6-4-5-7-16(15)20(24)27/h4-7,13H,8-11H2,1-3H3 |
| InChIKey | GAWHPIAWSJVHTM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 121.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|