C21H19Cl2N3O5S — CID 55337844
2-[1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 55337844) has the molecular formula C21H19Cl2N3O5S and a molecular weight of 496.37 g/mol. Its IUPAC name is 2-[1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55337844 |
| Molecular Formula | C21H19Cl2N3O5S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 2-[1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19Cl2N3O5S/c1-13(26-20(28)14-5-2-3-6-15(14)21(26)29)19(27)24-9-11-25(12-10-24)32(30,31)18-16(22)7-4-8-17(18)23/h2-8,13H,9-12H2,1H3 |
| InChIKey | FCQCFJFKFYVGIM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|