C13H18ClN3O3S — CID 119269678
(2R)-2-amino-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 119269678) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.82 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-amino-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119269678 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2R)-2-amino-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | C[C@@H](N)C(=O)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-10(15)13(18)16-6-8-17(9-7-16)21(19,20)12-5-3-2-4-11(12)14/h2-5,10H,6-9,15H2,1H3/t10-/m1/s1 |
| InChIKey | LRMTUTYMBKRJQM-SNVBAGLBSA-N |
| XLogP | 0.52 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |