C14H19Cl2N3O3S — CID 119678970
3-amino-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 119678970) has the molecular formula C14H19Cl2N3O3S and a molecular weight of 380.30 g/mol. Its IUPAC name is 3-amino-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 3-amino-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119678970 |
| Molecular Formula | C14H19Cl2N3O3S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3-amino-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CC(N)CC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O3S/c1-10(17)9-13(20)18-5-7-19(8-6-18)23(21,22)12-4-2-3-11(15)14(12)16/h2-4,10H,5-9,17H2,1H3 |
| InChIKey | NZVOKGBLXKGAPK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |