C8H18N4O3S — CID 61042216
4-(3-aminobutanoyl)piperazine-1-sulfonamide (PubChem CID 61042216) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(3-aminobutanoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(3-aminobutanoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61042216 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-(3-aminobutanoyl)piperazine-1-sulfonamide |
| SMILES | CC(N)CC(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-7(9)6-8(13)11-2-4-12(5-3-11)16(10,14)15/h7H,2-6,9H2,1H3,(H2,10,14,15) |
| InChIKey | WNSSWHHFCBJAEA-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |