C24H23ClN2O3S — CID 112764850
1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2,2-diphenylethanone (PubChem CID 112764850) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 112764850 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H23ClN2O3S/c25-21-13-7-8-14-22(21)31(29,30)27-17-15-26(16-18-27)24(28)23(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,23H,15-18H2 |
| InChIKey | UDIGXLFOZTXPSZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |