C26H22ClN3O8 — CID 3955740
[1-[4-(furan-2-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 3955740) has the molecular formula C26H22ClN3O8 and a molecular weight of 539.93 g/mol. Its IUPAC name is [1-[4-(furan-2-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [1-[4-(furan-2-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 3955740 |
| Molecular Formula | C26H22ClN3O8 |
| Molecular Weight | 539.93 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [1-[4-(furan-2-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C26H22ClN3O8/c1-16(24(32)28-10-12-29(13-11-28)25(33)22-7-4-14-37-22)38-26(34)19-6-3-2-5-18(19)23(31)17-8-9-20(27)21(15-17)30(35)36/h2-9,14-16H,10-13H2,1H3 |
| InChIKey | ZMGUTOOPNFJVFQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|