C18H19ClN2O4 — CID 38909009
(2R)-2-(2-chlorophenoxy)-1-[4-(furan-2-carbonyl)piperazin-1-yl]propan-1-one (PubChem CID 38909009) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-1-[4-(furan-2-carbonyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-(2-chlorophenoxy)-1-[4-(furan-2-carbonyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 38909009 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-1-[4-(furan-2-carbonyl)piperazin-1-yl]propan-1-one |
| SMILES | C[C@@H](Oc1ccccc1Cl)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-13(25-15-6-3-2-5-14(15)19)17(22)20-8-10-21(11-9-20)18(23)16-7-4-12-24-16/h2-7,12-13H,8-11H2,1H3/t13-/m1/s1 |
| InChIKey | QJIBHELPAVTACL-CYBMUJFWSA-N |
| XLogP | 2.68 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |