C15H14Cl2N2O2 — CID 113080480
[4-(2,3-dichlorophenyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 113080480) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.19 g/mol. Its IUPAC name is [4-(2,3-dichlorophenyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(2,3-dichlorophenyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 113080480 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [4-(2,3-dichlorophenyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-11-3-1-4-12(14(11)17)18-6-8-19(9-7-18)15(20)13-5-2-10-21-13/h1-5,10H,6-9H2 |
| InChIKey | CGTOHYFSZMDQCH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |