C16H15N3O4 — CID 110358026
7-[4-(furan-2-carbonyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 110358026) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 7-[4-(furan-2-carbonyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[4-(furan-2-carbonyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110358026 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 7-[4-(furan-2-carbonyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccco1)N1CCN(c2cccc3[nH]c(=O)oc23)CC1 |
| InChI | InChI=1S/C16H15N3O4/c20-15(13-5-2-10-22-13)19-8-6-18(7-9-19)12-4-1-3-11-14(12)23-16(21)17-11/h1-5,10H,6-9H2,(H,17,21) |
| InChIKey | UEWLINTUASYBNH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |