C23H15Cl3N2O6 — CID 4643672
[1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 4643672) has the molecular formula C23H15Cl3N2O6 and a molecular weight of 521.74 g/mol. Its IUPAC name is [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 4643672 |
| Molecular Formula | C23H15Cl3N2O6 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H15Cl3N2O6/c1-12(22(30)27-18-8-4-7-17(25)20(18)26)34-23(31)15-6-3-2-5-14(15)21(29)13-9-10-16(24)19(11-13)28(32)33/h2-12H,1H3,(H,27,30) |
| InChIKey | AFDBLPLOPGPCTM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|