C23H25Cl2N3O5 — CID 4070021
[1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 4070021) has the molecular formula C23H25Cl2N3O5 and a molecular weight of 494.38 g/mol. Its IUPAC name is [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4070021 |
| Molecular Formula | C23H25Cl2N3O5 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)OC(C)C(=O)Nc3cccc(Cl)c3Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H25Cl2N3O5/c1-13-9-14(2)12-27(11-13)19-8-7-16(10-20(19)28(31)32)23(30)33-15(3)22(29)26-18-6-4-5-17(24)21(18)25/h4-8,10,13-15H,9,11-12H2,1-3H3,(H,26,29) |
| InChIKey | OTKCOWCTUUTXNF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|