C17H22N4O6 — CID 4211439
[1-(carbamoylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 4211439) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4211439 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OC(C)C(=O)NC(N)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22N4O6/c1-10-5-7-20(8-6-10)13-4-3-12(9-14(13)21(25)26)16(23)27-11(2)15(22)19-17(18)24/h3-4,9-11H,5-8H2,1-2H3,(H3,18,19,22,24) |
| InChIKey | VDSQGARIMAMPRA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|