C23H23ClN2O7 — CID 55313957
[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 55313957) has the molecular formula C23H23ClN2O7 and a molecular weight of 474.90 g/mol. Its IUPAC name is [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 55313957 |
| Molecular Formula | C23H23ClN2O7 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | CC1CN(C(=O)C(C)OC(=O)c2ccccc2C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C23H23ClN2O7/c1-13-11-25(12-14(2)32-13)22(28)15(3)33-23(29)18-7-5-4-6-17(18)21(27)16-8-9-19(24)20(10-16)26(30)31/h4-10,13-15H,11-12H2,1-3H3 |
| InChIKey | SPMPIGCQWUAOOQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|