C26H29N3O7S — CID 87955728
tert-butyl 4-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 87955728) has the molecular formula C26H29N3O7S and a molecular weight of 527.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87955728 |
| Molecular Formula | C26H29N3O7S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | tert-butyl 4-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | C=C(C(=O)N1CCN(C(=O)OC(C)(C)C)CC1)c1ccc(Sc2ccc3c(c2)CCOO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H29N3O7S/c1-17(24(30)27-10-12-28(13-11-27)25(31)35-26(2,3)4)18-5-8-23(21(16-18)29(32)33)37-20-6-7-22-19(15-20)9-14-34-36-22/h5-8,15-16H,1,9-14H2,2-4H3 |
| InChIKey | JRKFIYCUEGVDHU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|