C16H13NO5S — CID 9111991
1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]ethanone (PubChem CID 9111991) has the molecular formula C16H13NO5S and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 9111991 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2ccc3c(c2)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13NO5S/c1-10(18)11-2-5-16(13(8-11)17(19)20)23-12-3-4-14-15(9-12)22-7-6-21-14/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | SABMVUOLLPTPEP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|