C10H10O3S — CID 117034091
S-(2,3-dihydro-1,4-benzodioxin-6-yl) ethanethioate (PubChem CID 117034091) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is S-(2,3-dihydro-1,4-benzodioxin-6-yl) ethanethioate.
| Compound Name | S-(2,3-dihydro-1,4-benzodioxin-6-yl) ethanethioate |
|---|---|
| PubChem CID | 117034091 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | S-(2,3-dihydro-1,4-benzodioxin-6-yl) ethanethioate |
| SMILES | CC(=O)Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H10O3S/c1-7(11)14-8-2-3-9-10(6-8)13-5-4-12-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | CEGLNKDVNRBVCR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|