About acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol
acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 71404632) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol.
Molecular Properties
| Compound Name | acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol |
| PubChem CID | 71404632 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | CC(=O)O.Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8O3.C2H4O2/c9-6-1-2-7-8(5-6)11-4-3-10-7;1-2(3)4/h1-2,5,9H,3-4H2;1H3,(H,3,4) |
| InChIKey | CFXMJXHQVIIBJN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol?
The IUPAC name of acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol (CID 71404632) is acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol.
What is the SMILES notation for acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol?
The canonical SMILES for acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol is CC(=O)O.Oc1ccc2c(c1)OCCO2.
What is the InChIKey of acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol?
The InChIKey is CFXMJXHQVIIBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C2H4O2/c9-6-1-2-7-8(5-6)11-4-3-10-7;1-2(3)4/h1-2,5,9H,3-4H2;1H3,(H,3,4).
What are the key properties of acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol?
acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol has a molecular weight of 212.20 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2,3-dihydro-1,4-benzodioxin-6-ol is sourced from PubChem (CID 71404632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).