C8H10O3 — CID 68940822
1,3-benzodioxol-5-ol;methane (PubChem CID 68940822) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ol;methane.
| Compound Name | 1,3-benzodioxol-5-ol;methane |
|---|---|
| PubChem CID | 68940822 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1,3-benzodioxol-5-ol;methane |
| SMILES | C.Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O3.CH4/c8-5-1-2-6-7(3-5)10-4-9-6;/h1-3,8H,4H2;1H4 |
| InChIKey | YGYZFEMUTIPACN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |