C16H12O5 — CID 171665791
2-(1,3-benzodioxol-5-yl)-7-hydroxy-2,3-dihydrochromen-4-one (PubChem CID 171665791) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-7-hydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-7-hydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 171665791 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-7-hydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccc3c(c2)OCO3)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C16H12O5/c17-10-2-3-11-12(18)7-14(21-15(11)6-10)9-1-4-13-16(5-9)20-8-19-13/h1-6,14,17H,7-8H2 |
| InChIKey | VJORMZRAQLJHFR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |