C8H8O5 — CID 22468167
1,3-benzodioxol-5-ol;formic acid (PubChem CID 22468167) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ol;formic acid.
| Compound Name | 1,3-benzodioxol-5-ol;formic acid |
|---|---|
| PubChem CID | 22468167 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1,3-benzodioxol-5-ol;formic acid |
| SMILES | O=CO.Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O3.CH2O2/c8-5-1-2-6-7(3-5)10-4-9-6;2-1-3/h1-3,8H,4H2;1H,(H,2,3) |
| InChIKey | QAUZMLXSGYJVMX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|