C18H14O4 — CID 54086101
2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3,4-dihydronaphthalen-1-one (PubChem CID 54086101) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 54086101 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylidene)-6-hydroxy-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2ccc3c(c2)OCO3)CCc2cc(O)ccc21 |
| InChI | InChI=1S/C18H14O4/c19-14-4-5-15-12(9-14)2-3-13(18(15)20)7-11-1-6-16-17(8-11)22-10-21-16/h1,4-9,19H,2-3,10H2 |
| InChIKey | MQOMXMVZYWYQDE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|