C21H16O5 — CID 59971328
2,3-bis(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-one (PubChem CID 59971328) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2,3-bis(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-one.
| Compound Name | 2,3-bis(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 59971328 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2,3-bis(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-one |
| SMILES | O=C1CCC(=Cc2ccc3c(c2)OCO3)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16O5/c22-17-4-3-15(7-13-1-5-18-20(9-13)25-11-23-18)16(17)8-14-2-6-19-21(10-14)26-12-24-19/h1-2,5-10H,3-4,11-12H2 |
| InChIKey | LCFJBZOMYOUERN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|