C18H23NO3 — CID 6914195
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[(dimethylamino)methyl]-2-ethylcyclopentan-1-one (PubChem CID 6914195) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[(dimethylamino)methyl]-2-ethylcyclopentan-1-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[(dimethylamino)methyl]-2-ethylcyclopentan-1-one |
|---|---|
| PubChem CID | 6914195 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[(dimethylamino)methyl]-2-ethylcyclopentan-1-one |
| SMILES | CCC1(CN(C)C)CC/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C18H23NO3/c1-4-18(11-19(2)3)8-7-14(17(18)20)9-13-5-6-15-16(10-13)22-12-21-15/h5-6,9-10H,4,7-8,11-12H2,1-3H3/b14-9+ |
| InChIKey | DBONBLFOSAQLDO-NTEUORMPSA-N |
| XLogP | 3.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|