C16H15NO3 — CID 92540142
(1R,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-3-oxocyclohexane-1-carbonitrile (PubChem CID 92540142) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (1R,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-3-oxocyclohexane-1-carbonitrile.
| Compound Name | (1R,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-3-oxocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 92540142 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1R,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-3-oxocyclohexane-1-carbonitrile |
| SMILES | C[C@@]1(C#N)CC/C(=C\c2ccc3c(c2)OCO3)C(=O)C1 |
| InChI | InChI=1S/C16H15NO3/c1-16(9-17)5-4-12(13(18)8-16)6-11-2-3-14-15(7-11)20-10-19-14/h2-3,6-7H,4-5,8,10H2,1H3/b12-6+/t16-/m1/s1 |
| InChIKey | UNNIWUDTQSWRDT-GXDWLZFVSA-N |
| XLogP | 3.08 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|