C17H18O4 — CID 2337495
2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 2337495) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 2337495 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(=Cc2ccc3c(c2)OCCO3)C(=O)C1 |
| InChI | InChI=1S/C17H18O4/c1-17(2)9-13(18)12(14(19)10-17)7-11-3-4-15-16(8-11)21-6-5-20-15/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | JMWHZQWNOHXJGE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|