C9H8O3 — CID 118916413
deuterio(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (PubChem CID 118916413) has the molecular formula C9H8O3 and a molecular weight of 165.17 g/mol. Its IUPAC name is deuterio(2,3-dihydro-1,4-benzodioxin-6-yl)methanone.
| Compound Name | deuterio(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
|---|---|
| PubChem CID | 118916413 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | deuterio(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| SMILES | [2H]C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H8O3/c10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5-6H,3-4H2/i6D |
| InChIKey | CWKXDPPQCVWXAG-RAMDWTOOSA-N |
| XLogP | 1.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|