C9H9NO3S — CID 123927050
6-[[(S)-tritiosulfinyl]iminomethyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 123927050) has the molecular formula C9H9NO3S and a molecular weight of 213.25 g/mol. Its IUPAC name is 6-[[(S)-tritiosulfinyl]iminomethyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[[(S)-tritiosulfinyl]iminomethyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 123927050 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 6-[[(S)-tritiosulfinyl]iminomethyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | [3H][S@](=O)N=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H9NO3S/c11-14-10-6-7-1-2-8-9(5-7)13-4-3-12-8/h1-2,5-6,14H,3-4H2/i14T |
| InChIKey | DDGVJAYYQLUGCY-UUEKIZJGSA-N |
| XLogP | 0.74 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|