C34H46N4O12 — CID 14149968
N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]butanediamide (PubChem CID 14149968) has the molecular formula C34H46N4O12 and a molecular weight of 702.76 g/mol. Its IUPAC name is N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]butanediamide.
| Compound Name | N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]butanediamide |
|---|---|
| PubChem CID | 14149968 |
| Molecular Formula | C34H46N4O12 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)N/N=C/c1ccc2c(c1)OCCOCCOCCOCCO2)N/N=C/c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C34H46N4O12/c39-33(37-35-25-27-1-3-29-31(23-27)49-21-17-45-13-9-41-7-11-43-15-19-47-29)5-6-34(40)38-36-26-28-2-4-30-32(24-28)50-22-18-46-14-10-42-8-12-44-16-20-48-30/h1-4,23-26H,5-22H2,(H,37,39)(H,38,40)/b35-25+,36-26+ |
| InChIKey | QHGHRIHXUUJMRV-DKKRNIPZSA-N |
| XLogP | 1.71 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|