C24H26N4O6 — CID 3401753
N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)hexanediamide (PubChem CID 3401753) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)hexanediamide.
| Compound Name | N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)hexanediamide |
|---|---|
| PubChem CID | 3401753 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)hexanediamide |
| SMILES | O=C(CCCCC(=O)NN=Cc1ccc2c(c1)OCCO2)NN=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H26N4O6/c29-23(27-25-15-17-5-7-19-21(13-17)33-11-9-31-19)3-1-2-4-24(30)28-26-16-18-6-8-20-22(14-18)34-12-10-32-20/h5-8,13-16H,1-4,9-12H2,(H,27,29)(H,28,30) |
| InChIKey | UYFOTUWOVBCFGV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|