C23H20N2O4 — CID 6266560
N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-(4-phenylphenoxy)acetamide (PubChem CID 6266560) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 6266560 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)N/N=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H20N2O4/c26-23(25-24-15-17-6-11-21-22(14-17)28-13-12-27-21)16-29-20-9-7-19(8-10-20)18-4-2-1-3-5-18/h1-11,14-15H,12-13,16H2,(H,25,26)/b24-15- |
| InChIKey | LVPXVESQNHINDC-IWIPYMOSSA-N |
| XLogP | 3.65 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|