C36H50N4O12 — CID 14149970
N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]hexanediamide (PubChem CID 14149970) has the molecular formula C36H50N4O12 and a molecular weight of 730.81 g/mol. Its IUPAC name is N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]hexanediamide |
|---|---|
| PubChem CID | 14149970 |
| Molecular Formula | C36H50N4O12 |
| Molecular Weight | 730.81 g/mol |
| Exact Mass | 730.34 |
| IUPAC Name | N,N'-bis[(E)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethylideneamino]hexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C/c1ccc2c(c1)OCCOCCOCCOCCO2)N/N=C/c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C36H50N4O12/c41-35(39-37-27-29-5-7-31-33(25-29)51-23-19-47-15-11-43-9-13-45-17-21-49-31)3-1-2-4-36(42)40-38-28-30-6-8-32-34(26-30)52-24-20-48-16-12-44-10-14-46-18-22-50-32/h5-8,25-28H,1-4,9-24H2,(H,39,41)(H,40,42)/b37-27+,38-28+ |
| InChIKey | JHPSUXLJXRJEJQ-RIGUPBQNSA-N |
| XLogP | 2.49 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.81 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|