C17H24O3S4 — CID 10883987
2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbaldehyde (PubChem CID 10883987) has the molecular formula C17H24O3S4 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbaldehyde.
| Compound Name | 2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbaldehyde |
|---|---|
| PubChem CID | 10883987 |
| Molecular Formula | C17H24O3S4 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)OCCSCCSCCSCCSCCO2 |
| InChI | InChI=1S/C17H24O3S4/c18-14-15-1-2-16-17(13-15)20-4-6-22-8-10-24-12-11-23-9-7-21-5-3-19-16/h1-2,13-14H,3-12H2 |
| InChIKey | LLQMXZBKWQCPIH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|