C17H25N3O4 — CID 131990832
2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),5,19,21-tetraene-21-carbaldehyde (PubChem CID 131990832) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),5,19,21-tetraene-21-carbaldehyde.
| Compound Name | 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),5,19,21-tetraene-21-carbaldehyde |
|---|---|
| PubChem CID | 131990832 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),5,19,21-tetraene-21-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)OCC/N=C/COCCNCCNCCO2 |
| InChI | InChI=1S/C17H25N3O4/c21-14-15-1-2-16-17(13-15)24-12-8-20-6-10-22-9-5-18-3-4-19-7-11-23-16/h1-2,6,13-14,18-19H,3-5,7-12H2/b20-6+ |
| InChIKey | RYOCYDATGVHHFJ-CGOBSMCZSA-N |
| XLogP | 0.54 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|