C15H21NO3 — CID 23291702
cyclohexanamine;2,3-dihydro-1,4-benzodioxine-6-carbaldehyde (PubChem CID 23291702) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is cyclohexanamine;2,3-dihydro-1,4-benzodioxine-6-carbaldehyde.
| Compound Name | cyclohexanamine;2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
|---|---|
| PubChem CID | 23291702 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | cyclohexanamine;2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
| SMILES | NC1CCCCC1.O=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H8O3.C6H13N/c10-6-7-1-2-8-9(5-7)12-4-3-11-8;7-6-4-2-1-3-5-6/h1-2,5-6H,3-4H2;6H,1-5,7H2 |
| InChIKey | LAQAVSHDGJRIKQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|