C16H23NO3S — CID 115479189
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)cyclooctan-1-amine (PubChem CID 115479189) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)cyclooctan-1-amine.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)cyclooctan-1-amine |
|---|---|
| PubChem CID | 115479189 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)cyclooctan-1-amine |
| SMILES | NC1CCCCCCC1S(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H23NO3S/c17-13-5-3-1-2-4-6-16(13)21(18)12-7-8-14-15(11-12)20-10-9-19-14/h7-8,11,13,16H,1-6,9-10,17H2 |
| InChIKey | WTFQHGFOKZIZJR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |